C33H39N3O9 — CID 10461547
[(2R,3R,4S,5R,6R)-4,5-bis[(3,5-dimethylphenyl)carbamoyloxy]-6-hydroxy-2-(hydroxymethyl)oxan-3-yl] N-(3,5-dimethylphenyl)carbamate (PubChem CID 10461547) has the molecular formula C33H39N3O9 and a molecular weight of 621.69 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-4,5-bis[(3,5-dimethylphenyl)carbamoyloxy]-6-hydroxy-2-(hydroxymethyl)oxan-3-yl] N-(3,5-dimethylphenyl)carbamate.
| Compound Name | [(2R,3R,4S,5R,6R)-4,5-bis[(3,5-dimethylphenyl)carbamoyloxy]-6-hydroxy-2-(hydroxymethyl)oxan-3-yl] N-(3,5-dimethylphenyl)carbamate |
|---|---|
| PubChem CID | 10461547 |
| Molecular Formula | C33H39N3O9 |
| Molecular Weight | 621.69 g/mol |
| Exact Mass | 621.27 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-4,5-bis[(3,5-dimethylphenyl)carbamoyloxy]-6-hydroxy-2-(hydroxymethyl)oxan-3-yl] N-(3,5-dimethylphenyl)carbamate |
| SMILES | Cc1cc(C)cc(NC(=O)O[C@@H]2[C@@H](OC(=O)Nc3cc(C)cc(C)c3)[C@H](O)O[C@H](CO)[C@H]2OC(=O)Nc2cc(C)cc(C)c2)c1 |
| InChI | InChI=1S/C33H39N3O9/c1-17-7-18(2)11-23(10-17)34-31(39)43-27-26(16-37)42-30(38)29(45-33(41)36-25-14-21(5)9-22(6)15-25)28(27)44-32(40)35-24-12-19(3)8-20(4)13-24/h7-15,26-30,37-38H,16H2,1-6H3,(H,34,39)(H,35,40)(H,36,41)/t26-,27-,28+,29-,30-/m1/s1 |
| InChIKey | WAYFOTLYBPRREF-CMPUJJQDSA-N |
| XLogP | 5.40 |
| TPSA | 164.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.69 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|