C14H18N4O3 — CID 104616629
2-amino-N-(4-ethyl-1H-pyrazol-5-yl)-3,5-dimethoxybenzamide (PubChem CID 104616629) has the molecular formula C14H18N4O3 and a molecular weight of 290.32 g/mol. Its IUPAC name is 2-amino-N-(4-ethyl-1H-pyrazol-5-yl)-3,5-dimethoxybenzamide.
| Compound Name | 2-amino-N-(4-ethyl-1H-pyrazol-5-yl)-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 104616629 |
| Molecular Formula | C14H18N4O3 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 2-amino-N-(4-ethyl-1H-pyrazol-5-yl)-3,5-dimethoxybenzamide |
| SMILES | CCc1cn[nH]c1NC(=O)c1cc(OC)cc(OC)c1N |
| InChI | InChI=1S/C14H18N4O3/c1-4-8-7-16-18-13(8)17-14(19)10-5-9(20-2)6-11(21-3)12(10)15/h5-7H,4,15H2,1-3H3,(H2,16,17,18,19) |
| InChIKey | LRAHCJHPYIDRBM-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 102.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|