C11H14N4O3S — CID 104617188
3-amino-N-(4-ethyl-1H-pyrazol-5-yl)-4-hydroxybenzenesulfonamide (PubChem CID 104617188) has the molecular formula C11H14N4O3S and a molecular weight of 282.32 g/mol. Its IUPAC name is 3-amino-N-(4-ethyl-1H-pyrazol-5-yl)-4-hydroxybenzenesulfonamide.
| Compound Name | 3-amino-N-(4-ethyl-1H-pyrazol-5-yl)-4-hydroxybenzenesulfonamide |
|---|---|
| PubChem CID | 104617188 |
| Molecular Formula | C11H14N4O3S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 3-amino-N-(4-ethyl-1H-pyrazol-5-yl)-4-hydroxybenzenesulfonamide |
| SMILES | CCc1cn[nH]c1NS(=O)(=O)c1ccc(O)c(N)c1 |
| InChI | InChI=1S/C11H14N4O3S/c1-2-7-6-13-14-11(7)15-19(17,18)8-3-4-10(16)9(12)5-8/h3-6,16H,2,12H2,1H3,(H2,13,14,15) |
| InChIKey | VBHWLLQBRLKHTQ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 121.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|