About 2-amino-4,6-dichloro-N-(4-ethyl-1H-pyrazol-5-yl)benzenesulfonamide
2-amino-4,6-dichloro-N-(4-ethyl-1H-pyrazol-5-yl)benzenesulfonamide (PubChem CID 104617270) has the molecular formula C11H12Cl2N4O2S
and a molecular weight of 335.22 g/mol. Its IUPAC name is 2-amino-4,6-dichloro-N-(4-ethyl-1H-pyrazol-5-yl)benzenesulfonamide.
Molecular Properties
| Compound Name | 2-amino-4,6-dichloro-N-(4-ethyl-1H-pyrazol-5-yl)benzenesulfonamide |
| PubChem CID | 104617270 |
| Molecular Formula | C11H12Cl2N4O2S |
| Molecular Weight | 335.22 g/mol |
| Exact Mass | 334.01 |
| IUPAC Name | 2-amino-4,6-dichloro-N-(4-ethyl-1H-pyrazol-5-yl)benzenesulfonamide |
| SMILES | CCc1cn[nH]c1NS(=O)(=O)c1c(N)cc(Cl)cc1Cl |
| InChI | InChI=1S/C11H12Cl2N4O2S/c1-2-6-5-15-16-11(6)17-20(18,19)10-8(13)3-7(12)4-9(10)14/h3-5H,2,14H2,1H3,(H2,15,16,17) |
| InChIKey | YCQQTSWQBQGZST-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.22 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-4,6-dichloro-N-(4-ethyl-1H-pyrazol-5-yl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4,6-dichloro-N-(4-ethyl-1H-pyrazol-5-yl)benzenesulfonamide?
The IUPAC name of 2-amino-4,6-dichloro-N-(4-ethyl-1H-pyrazol-5-yl)benzenesulfonamide (CID 104617270) is 2-amino-4,6-dichloro-N-(4-ethyl-1H-pyrazol-5-yl)benzenesulfonamide.
What is the SMILES notation for 2-amino-4,6-dichloro-N-(4-ethyl-1H-pyrazol-5-yl)benzenesulfonamide?
The canonical SMILES for 2-amino-4,6-dichloro-N-(4-ethyl-1H-pyrazol-5-yl)benzenesulfonamide is CCc1cn[nH]c1NS(=O)(=O)c1c(N)cc(Cl)cc1Cl.
What is the InChIKey of 2-amino-4,6-dichloro-N-(4-ethyl-1H-pyrazol-5-yl)benzenesulfonamide?
The InChIKey is YCQQTSWQBQGZST-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12Cl2N4O2S/c1-2-6-5-15-16-11(6)17-20(18,19)10-8(13)3-7(12)4-9(10)14/h3-5H,2,14H2,1H3,(H2,15,16,17).
What are the key properties of 2-amino-4,6-dichloro-N-(4-ethyl-1H-pyrazol-5-yl)benzenesulfonamide?
2-amino-4,6-dichloro-N-(4-ethyl-1H-pyrazol-5-yl)benzenesulfonamide has a molecular weight of 335.22 g/mol, XLogP of 2.66, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4,6-dichloro-N-(4-ethyl-1H-pyrazol-5-yl)benzenesulfonamide is sourced from PubChem (CID 104617270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).