C9H16N4O — CID 104620385
1-ethyl-3-(5-ethyl-1H-pyrazol-3-yl)-1-methylurea (PubChem CID 104620385) has the molecular formula C9H16N4O and a molecular weight of 196.25 g/mol. Its IUPAC name is 1-ethyl-3-(5-ethyl-1H-pyrazol-3-yl)-1-methylurea.
| Compound Name | 1-ethyl-3-(5-ethyl-1H-pyrazol-3-yl)-1-methylurea |
|---|---|
| PubChem CID | 104620385 |
| Molecular Formula | C9H16N4O |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | 1-ethyl-3-(5-ethyl-1H-pyrazol-3-yl)-1-methylurea |
| SMILES | CCc1cc(NC(=O)N(C)CC)n[nH]1 |
| InChI | InChI=1S/C9H16N4O/c1-4-7-6-8(12-11-7)10-9(14)13(3)5-2/h6H,4-5H2,1-3H3,(H2,10,11,12,14) |
| InChIKey | GLZSPZNHJLUPRE-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |