C8H12N4O2S — CID 104620764
1-cyano-N-(5-propan-2-yl-1H-pyrazol-3-yl)methanesulfonamide (PubChem CID 104620764) has the molecular formula C8H12N4O2S and a molecular weight of 228.28 g/mol. Its IUPAC name is 1-cyano-N-(5-propan-2-yl-1H-pyrazol-3-yl)methanesulfonamide.
| Compound Name | 1-cyano-N-(5-propan-2-yl-1H-pyrazol-3-yl)methanesulfonamide |
|---|---|
| PubChem CID | 104620764 |
| Molecular Formula | C8H12N4O2S |
| Molecular Weight | 228.28 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | 1-cyano-N-(5-propan-2-yl-1H-pyrazol-3-yl)methanesulfonamide |
| SMILES | CC(C)c1cc(NS(=O)(=O)CC#N)n[nH]1 |
| InChI | InChI=1S/C8H12N4O2S/c1-6(2)7-5-8(11-10-7)12-15(13,14)4-3-9/h5-6H,4H2,1-2H3,(H2,10,11,12) |
| InChIKey | MBSXVRPCMIWMNC-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 98.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.28 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |