C9H14F3N3O2S — CID 104621057
N-(4-ethyl-1H-pyrazol-5-yl)-4,4,4-trifluorobutane-1-sulfonamide (PubChem CID 104621057) has the molecular formula C9H14F3N3O2S and a molecular weight of 285.29 g/mol. Its IUPAC name is N-(4-ethyl-1H-pyrazol-5-yl)-4,4,4-trifluorobutane-1-sulfonamide.
| Compound Name | N-(4-ethyl-1H-pyrazol-5-yl)-4,4,4-trifluorobutane-1-sulfonamide |
|---|---|
| PubChem CID | 104621057 |
| Molecular Formula | C9H14F3N3O2S |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | N-(4-ethyl-1H-pyrazol-5-yl)-4,4,4-trifluorobutane-1-sulfonamide |
| SMILES | CCc1cn[nH]c1NS(=O)(=O)CCCC(F)(F)F |
| InChI | InChI=1S/C9H14F3N3O2S/c1-2-7-6-13-14-8(7)15-18(16,17)5-3-4-9(10,11)12/h6H,2-5H2,1H3,(H2,13,14,15) |
| InChIKey | GDUBUNABHJOIJK-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |