C12H14FN3O2S — CID 104621163
N-(4-ethyl-1H-pyrazol-5-yl)-4-fluoro-2-methylbenzenesulfonamide (PubChem CID 104621163) has the molecular formula C12H14FN3O2S and a molecular weight of 283.33 g/mol. Its IUPAC name is N-(4-ethyl-1H-pyrazol-5-yl)-4-fluoro-2-methylbenzenesulfonamide.
| Compound Name | N-(4-ethyl-1H-pyrazol-5-yl)-4-fluoro-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 104621163 |
| Molecular Formula | C12H14FN3O2S |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | N-(4-ethyl-1H-pyrazol-5-yl)-4-fluoro-2-methylbenzenesulfonamide |
| SMILES | CCc1cn[nH]c1NS(=O)(=O)c1ccc(F)cc1C |
| InChI | InChI=1S/C12H14FN3O2S/c1-3-9-7-14-15-12(9)16-19(17,18)11-5-4-10(13)6-8(11)2/h4-7H,3H2,1-2H3,(H2,14,15,16) |
| InChIKey | RQWJPWWMTRQMBQ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |