C6H10BrN3O2S — CID 104621211
1-bromo-N-(5-ethyl-1H-pyrazol-3-yl)methanesulfonamide (PubChem CID 104621211) has the molecular formula C6H10BrN3O2S and a molecular weight of 268.14 g/mol. Its IUPAC name is 1-bromo-N-(5-ethyl-1H-pyrazol-3-yl)methanesulfonamide.
| Compound Name | 1-bromo-N-(5-ethyl-1H-pyrazol-3-yl)methanesulfonamide |
|---|---|
| PubChem CID | 104621211 |
| Molecular Formula | C6H10BrN3O2S |
| Molecular Weight | 268.14 g/mol |
| Exact Mass | 266.97 |
| IUPAC Name | 1-bromo-N-(5-ethyl-1H-pyrazol-3-yl)methanesulfonamide |
| SMILES | CCc1cc(NS(=O)(=O)CBr)n[nH]1 |
| InChI | InChI=1S/C6H10BrN3O2S/c1-2-5-3-6(9-8-5)10-13(11,12)4-7/h3H,2,4H2,1H3,(H2,8,9,10) |
| InChIKey | SYOWMRNDAQRCCP-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.14 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|