C12H18N4 — CID 104621816
N-[(3-ethylpyrazolo[1,5-a]pyrimidin-6-yl)methyl]propan-1-amine (PubChem CID 104621816) has the molecular formula C12H18N4 and a molecular weight of 218.30 g/mol. Its IUPAC name is N-[(3-ethylpyrazolo[1,5-a]pyrimidin-6-yl)methyl]propan-1-amine.
| Compound Name | N-[(3-ethylpyrazolo[1,5-a]pyrimidin-6-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 104621816 |
| Molecular Formula | C12H18N4 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | N-[(3-ethylpyrazolo[1,5-a]pyrimidin-6-yl)methyl]propan-1-amine |
| SMILES | CCCNCc1cnc2c(CC)cnn2c1 |
| InChI | InChI=1S/C12H18N4/c1-3-5-13-6-10-7-14-12-11(4-2)8-15-16(12)9-10/h7-9,13H,3-6H2,1-2H3 |
| InChIKey | GCQBLZFVRAABEI-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|