C11H19F3N2O — CID 104621885
N-(2-aminoethyl)-N-methyl-2-(trifluoromethyl)cyclohexane-1-carboxamide (PubChem CID 104621885) has the molecular formula C11H19F3N2O and a molecular weight of 252.28 g/mol. Its IUPAC name is N-(2-aminoethyl)-N-methyl-2-(trifluoromethyl)cyclohexane-1-carboxamide.
| Compound Name | N-(2-aminoethyl)-N-methyl-2-(trifluoromethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 104621885 |
| Molecular Formula | C11H19F3N2O |
| Molecular Weight | 252.28 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | N-(2-aminoethyl)-N-methyl-2-(trifluoromethyl)cyclohexane-1-carboxamide |
| SMILES | CN(CCN)C(=O)C1CCCCC1C(F)(F)F |
| InChI | InChI=1S/C11H19F3N2O/c1-16(7-6-15)10(17)8-4-2-3-5-9(8)11(12,13)14/h8-9H,2-7,15H2,1H3 |
| InChIKey | ZIMRGUVGPSUJJY-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.28 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |