C41H57N5O4 — CID 10462250
(2S,4S)-2-N-[2-[(2-methoxyphenyl)methyl-methylamino]ethyl]-4-N,4-N-dipentyl-1-N,1-N-diphenylpiperidine-1,2,4-tricarboxamide (PubChem CID 10462250) has the molecular formula C41H57N5O4 and a molecular weight of 683.94 g/mol. Its IUPAC name is (2S,4S)-2-N-[2-[(2-methoxyphenyl)methyl-methylamino]ethyl]-4-N,4-N-dipentyl-1-N,1-N-diphenylpiperidine-1,2,4-tricarboxamide.
| Compound Name | (2S,4S)-2-N-[2-[(2-methoxyphenyl)methyl-methylamino]ethyl]-4-N,4-N-dipentyl-1-N,1-N-diphenylpiperidine-1,2,4-tricarboxamide |
|---|---|
| PubChem CID | 10462250 |
| Molecular Formula | C41H57N5O4 |
| Molecular Weight | 683.94 g/mol |
| Exact Mass | 683.44 |
| IUPAC Name | (2S,4S)-2-N-[2-[(2-methoxyphenyl)methyl-methylamino]ethyl]-4-N,4-N-dipentyl-1-N,1-N-diphenylpiperidine-1,2,4-tricarboxamide |
| SMILES | CCCCCN(CCCCC)C(=O)[C@H]1CCN(C(=O)N(c2ccccc2)c2ccccc2)[C@H](C(=O)NCCN(C)Cc2ccccc2OC)C1 |
| InChI | InChI=1S/C41H57N5O4/c1-5-7-17-27-44(28-18-8-6-2)40(48)33-25-29-45(41(49)46(35-20-11-9-12-21-35)36-22-13-10-14-23-36)37(31-33)39(47)42-26-30-43(3)32-34-19-15-16-24-38(34)50-4/h9-16,19-24,33,37H,5-8,17-18,25-32H2,1-4H3,(H,42,47)/t33-,37-/m0/s1 |
| InChIKey | PYMQWQVPOYGEIM-WNOXWKSXSA-N |
| XLogP | 7.49 |
| TPSA | 85.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.94 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|