C30H28F6N6O5S — CID 10462369
1-[5-[[5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3-(methanesulfonamido)-2-methoxyphenyl]carbamoyl]-2-methylphenyl]-N-(1-phenylethyl)triazole-4-carboxamide (PubChem CID 10462369) has the molecular formula C30H28F6N6O5S and a molecular weight of 698.65 g/mol. Its IUPAC name is 1-[5-[[5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3-(methanesulfonamido)-2-methoxyphenyl]carbamoyl]-2-methylphenyl]-N-(1-phenylethyl)triazole-4-carboxamide.
| Compound Name | 1-[5-[[5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3-(methanesulfonamido)-2-methoxyphenyl]carbamoyl]-2-methylphenyl]-N-(1-phenylethyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 10462369 |
| Molecular Formula | C30H28F6N6O5S |
| Molecular Weight | 698.65 g/mol |
| Exact Mass | 698.17 |
| IUPAC Name | 1-[5-[[5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3-(methanesulfonamido)-2-methoxyphenyl]carbamoyl]-2-methylphenyl]-N-(1-phenylethyl)triazole-4-carboxamide |
| SMILES | COc1c(NC(=O)c2ccc(C)c(-n3cc(C(=O)NC(C)c4ccccc4)nn3)c2)cc(C(C(F)(F)F)C(F)(F)F)cc1NS(C)(=O)=O |
| InChI | InChI=1S/C30H28F6N6O5S/c1-16-10-11-19(14-24(16)42-15-23(39-41-42)28(44)37-17(2)18-8-6-5-7-9-18)27(43)38-21-12-20(26(29(31,32)33)30(34,35)36)13-22(25(21)47-3)40-48(4,45)46/h5-15,17,26,40H,1-4H3,(H,37,44)(H,38,43) |
| InChIKey | VRZHJBDQJUZDEO-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 144.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.65 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |