C41H69N3O4S — CID 10462385
38-hydroxy-36-thia-1,13,25-triazatricyclo[36.7.0.039,44]pentatetraconta-39,41,43-triene-12,24,45-trione (PubChem CID 10462385) has the molecular formula C41H69N3O4S and a molecular weight of 700.09 g/mol. Its IUPAC name is 38-hydroxy-36-thia-1,13,25-triazatricyclo[36.7.0.039,44]pentatetraconta-39,41,43-triene-12,24,45-trione.
| Compound Name | 38-hydroxy-36-thia-1,13,25-triazatricyclo[36.7.0.039,44]pentatetraconta-39,41,43-triene-12,24,45-trione |
|---|---|
| PubChem CID | 10462385 |
| Molecular Formula | C41H69N3O4S |
| Molecular Weight | 700.09 g/mol |
| Exact Mass | 699.50 |
| IUPAC Name | 38-hydroxy-36-thia-1,13,25-triazatricyclo[36.7.0.039,44]pentatetraconta-39,41,43-triene-12,24,45-trione |
| SMILES | O=C1CCCCCCCCCCNC(=O)CCCCCCCCCCN2C(=O)c3ccccc3C2(O)CSCCCCCCCCCCN1 |
| InChI | InChI=1S/C41H69N3O4S/c45-38-29-19-13-7-1-3-9-15-23-31-42-39(46)30-20-14-8-2-5-11-17-25-33-44-40(47)36-27-21-22-28-37(36)41(44,48)35-49-34-26-18-12-6-4-10-16-24-32-43-38/h21-22,27-28,48H,1-20,23-26,29-35H2,(H,42,46)(H,43,45) |
| InChIKey | AMIIYBOXPMBVGD-UHFFFAOYSA-N |
| XLogP | 9.41 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.09 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |