C12H27N3O — CID 104624160
3-[3-(dimethylamino)-2,2-dimethylpropyl]-1,1-diethylurea (PubChem CID 104624160) has the molecular formula C12H27N3O and a molecular weight of 229.37 g/mol. Its IUPAC name is 3-[3-(dimethylamino)-2,2-dimethylpropyl]-1,1-diethylurea.
| Compound Name | 3-[3-(dimethylamino)-2,2-dimethylpropyl]-1,1-diethylurea |
|---|---|
| PubChem CID | 104624160 |
| Molecular Formula | C12H27N3O |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.22 |
| IUPAC Name | 3-[3-(dimethylamino)-2,2-dimethylpropyl]-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)NCC(C)(C)CN(C)C |
| InChI | InChI=1S/C12H27N3O/c1-7-15(8-2)11(16)13-9-12(3,4)10-14(5)6/h7-10H2,1-6H3,(H,13,16) |
| InChIKey | MHJMTFOGPXGNCV-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |