C12H12ClN5O — CID 104624330
N-(6-chloropyridazin-3-yl)-3-ethyl-6-methylpyridazine-4-carboxamide (PubChem CID 104624330) has the molecular formula C12H12ClN5O and a molecular weight of 277.72 g/mol. Its IUPAC name is N-(6-chloropyridazin-3-yl)-3-ethyl-6-methylpyridazine-4-carboxamide.
| Compound Name | N-(6-chloropyridazin-3-yl)-3-ethyl-6-methylpyridazine-4-carboxamide |
|---|---|
| PubChem CID | 104624330 |
| Molecular Formula | C12H12ClN5O |
| Molecular Weight | 277.72 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | N-(6-chloropyridazin-3-yl)-3-ethyl-6-methylpyridazine-4-carboxamide |
| SMILES | CCc1nnc(C)cc1C(=O)Nc1ccc(Cl)nn1 |
| InChI | InChI=1S/C12H12ClN5O/c1-3-9-8(6-7(2)15-16-9)12(19)14-11-5-4-10(13)17-18-11/h4-6H,3H2,1-2H3,(H,14,18,19) |
| InChIKey | UVFUYIWFJWOJJF-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 80.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.72 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |