C15H12BrClN2O2 — CID 104624688
N-(5-bromo-6-chloro-3-pyridinyl)-3,4-dihydro-1H-isochromene-1-carboxamide (PubChem CID 104624688) has the molecular formula C15H12BrClN2O2 and a molecular weight of 367.63 g/mol. Its IUPAC name is N-(5-bromo-6-chloro-3-pyridinyl)-3,4-dihydro-1H-isochromene-1-carboxamide.
| Compound Name | N-(5-bromo-6-chloro-3-pyridinyl)-3,4-dihydro-1H-isochromene-1-carboxamide |
|---|---|
| PubChem CID | 104624688 |
| Molecular Formula | C15H12BrClN2O2 |
| Molecular Weight | 367.63 g/mol |
| Exact Mass | 365.98 |
| IUPAC Name | N-(5-bromo-6-chloro-3-pyridinyl)-3,4-dihydro-1H-isochromene-1-carboxamide |
| SMILES | O=C(Nc1cnc(Cl)c(Br)c1)C1OCCc2ccccc21 |
| InChI | InChI=1S/C15H12BrClN2O2/c16-12-7-10(8-18-14(12)17)19-15(20)13-11-4-2-1-3-9(11)5-6-21-13/h1-4,7-8,13H,5-6H2,(H,19,20) |
| InChIKey | YYQNCSKGKNCDNZ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.63 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|