C9H16F3NO2 — CID 104625819
2,2,2-trifluoro-N-(4-methoxy-2,2-dimethylbutyl)acetamide (PubChem CID 104625819) has the molecular formula C9H16F3NO2 and a molecular weight of 227.23 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-(4-methoxy-2,2-dimethylbutyl)acetamide.
| Compound Name | 2,2,2-trifluoro-N-(4-methoxy-2,2-dimethylbutyl)acetamide |
|---|---|
| PubChem CID | 104625819 |
| Molecular Formula | C9H16F3NO2 |
| Molecular Weight | 227.23 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 2,2,2-trifluoro-N-(4-methoxy-2,2-dimethylbutyl)acetamide |
| SMILES | COCCC(C)(C)CNC(=O)C(F)(F)F |
| InChI | InChI=1S/C9H16F3NO2/c1-8(2,4-5-15-3)6-13-7(14)9(10,11)12/h4-6H2,1-3H3,(H,13,14) |
| InChIKey | GRQMGKCAETZZMC-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.23 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |