C11H16N2O4 — CID 104630036
N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-2-oxo-1H-pyridine-4-carboxamide (PubChem CID 104630036) has the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. Its IUPAC name is N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-2-oxo-1H-pyridine-4-carboxamide.
| Compound Name | N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-2-oxo-1H-pyridine-4-carboxamide |
|---|---|
| PubChem CID | 104630036 |
| Molecular Formula | C11H16N2O4 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-2-oxo-1H-pyridine-4-carboxamide |
| SMILES | CCC(CO)(CO)NC(=O)c1cc[nH]c(=O)c1 |
| InChI | InChI=1S/C11H16N2O4/c1-2-11(6-14,7-15)13-10(17)8-3-4-12-9(16)5-8/h3-5,14-15H,2,6-7H2,1H3,(H,12,16)(H,13,17) |
| InChIKey | CLBQBGXOZUYRBZ-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |