C11H19NO4 — CID 104630614
(2R)-N-[4-(hydroxymethyl)oxan-4-yl]oxolane-2-carboxamide (PubChem CID 104630614) has the molecular formula C11H19NO4 and a molecular weight of 229.28 g/mol. Its IUPAC name is (2R)-N-[4-(hydroxymethyl)oxan-4-yl]oxolane-2-carboxamide.
| Compound Name | (2R)-N-[4-(hydroxymethyl)oxan-4-yl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 104630614 |
| Molecular Formula | C11H19NO4 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | (2R)-N-[4-(hydroxymethyl)oxan-4-yl]oxolane-2-carboxamide |
| SMILES | O=C(NC1(CO)CCOCC1)[C@H]1CCCO1 |
| InChI | InChI=1S/C11H19NO4/c13-8-11(3-6-15-7-4-11)12-10(14)9-2-1-5-16-9/h9,13H,1-8H2,(H,12,14)/t9-/m1/s1 |
| InChIKey | ZLQCOXUHAGXRAA-SECBINFHSA-N |
| XLogP | -0.18 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |