C7H4F4N2O3 — CID 104632690
(E)-3-[5-(1,1,2,2-tetrafluoroethyl)-1,3,4-oxadiazol-2-yl]prop-2-enoic acid (PubChem CID 104632690) has the molecular formula C7H4F4N2O3 and a molecular weight of 240.11 g/mol. Its IUPAC name is (E)-3-[5-(1,1,2,2-tetrafluoroethyl)-1,3,4-oxadiazol-2-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-(1,1,2,2-tetrafluoroethyl)-1,3,4-oxadiazol-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 104632690 |
| Molecular Formula | C7H4F4N2O3 |
| Molecular Weight | 240.11 g/mol |
| Exact Mass | 240.02 |
| IUPAC Name | (E)-3-[5-(1,1,2,2-tetrafluoroethyl)-1,3,4-oxadiazol-2-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1nnc(C(F)(F)C(F)F)o1 |
| InChI | InChI=1S/C7H4F4N2O3/c8-5(9)7(10,11)6-13-12-3(16-6)1-2-4(14)15/h1-2,5H,(H,14,15)/b2-1+ |
| InChIKey | LEQMJXKQKQLNMD-OWOJBTEDSA-N |
| XLogP | 1.52 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.11 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|