C5HF5N2O3 — CID 104632693
5-(1,1,2,2,2-pentafluoroethyl)-1,3,4-oxadiazole-2-carboxylic acid (PubChem CID 104632693) has the molecular formula C5HF5N2O3 and a molecular weight of 232.06 g/mol. Its IUPAC name is 5-(1,1,2,2,2-pentafluoroethyl)-1,3,4-oxadiazole-2-carboxylic acid.
| Compound Name | 5-(1,1,2,2,2-pentafluoroethyl)-1,3,4-oxadiazole-2-carboxylic acid |
|---|---|
| PubChem CID | 104632693 |
| Molecular Formula | C5HF5N2O3 |
| Molecular Weight | 232.06 g/mol |
| Exact Mass | 231.99 |
| IUPAC Name | 5-(1,1,2,2,2-pentafluoroethyl)-1,3,4-oxadiazole-2-carboxylic acid |
| SMILES | O=C(O)c1nnc(C(F)(F)C(F)(F)F)o1 |
| InChI | InChI=1S/C5HF5N2O3/c6-4(7,5(8,9)10)3-12-11-1(15-3)2(13)14/h(H,13,14) |
| InChIKey | ZUZFEZHAQCATFT-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.06 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|