C8H12ClF2N3O — CID 104632808
3-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]pentan-3-amine (PubChem CID 104632808) has the molecular formula C8H12ClF2N3O and a molecular weight of 239.65 g/mol. Its IUPAC name is 3-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]pentan-3-amine.
| Compound Name | 3-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]pentan-3-amine |
|---|---|
| PubChem CID | 104632808 |
| Molecular Formula | C8H12ClF2N3O |
| Molecular Weight | 239.65 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | 3-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]pentan-3-amine |
| SMILES | CCC(N)(CC)c1noc(C(F)(F)Cl)n1 |
| InChI | InChI=1S/C8H12ClF2N3O/c1-3-7(12,4-2)5-13-6(15-14-5)8(9,10)11/h3-4,12H2,1-2H3 |
| InChIKey | FNQFVQSIMSKDSK-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.65 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|