C5H4F5N3O — CID 104632906
[5-(1,1,2,2,2-pentafluoroethyl)-1,3,4-oxadiazol-2-yl]methanamine (PubChem CID 104632906) has the molecular formula C5H4F5N3O and a molecular weight of 217.10 g/mol. Its IUPAC name is [5-(1,1,2,2,2-pentafluoroethyl)-1,3,4-oxadiazol-2-yl]methanamine.
| Compound Name | [5-(1,1,2,2,2-pentafluoroethyl)-1,3,4-oxadiazol-2-yl]methanamine |
|---|---|
| PubChem CID | 104632906 |
| Molecular Formula | C5H4F5N3O |
| Molecular Weight | 217.10 g/mol |
| Exact Mass | 217.03 |
| IUPAC Name | [5-(1,1,2,2,2-pentafluoroethyl)-1,3,4-oxadiazol-2-yl]methanamine |
| SMILES | NCc1nnc(C(F)(F)C(F)(F)F)o1 |
| InChI | InChI=1S/C5H4F5N3O/c6-4(7,5(8,9)10)3-13-12-2(1-11)14-3/h1,11H2 |
| InChIKey | DYRCPYGJRGTJCH-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.10 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|