C10H13F5N4O2 — CID 104636187
2-morpholin-4-yl-1-[5-(1,1,2,2,2-pentafluoroethyl)-1,2,4-oxadiazol-3-yl]ethanamine (PubChem CID 104636187) has the molecular formula C10H13F5N4O2 and a molecular weight of 316.23 g/mol. Its IUPAC name is 2-morpholin-4-yl-1-[5-(1,1,2,2,2-pentafluoroethyl)-1,2,4-oxadiazol-3-yl]ethanamine.
| Compound Name | 2-morpholin-4-yl-1-[5-(1,1,2,2,2-pentafluoroethyl)-1,2,4-oxadiazol-3-yl]ethanamine |
|---|---|
| PubChem CID | 104636187 |
| Molecular Formula | C10H13F5N4O2 |
| Molecular Weight | 316.23 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 2-morpholin-4-yl-1-[5-(1,1,2,2,2-pentafluoroethyl)-1,2,4-oxadiazol-3-yl]ethanamine |
| SMILES | NC(CN1CCOCC1)c1noc(C(F)(F)C(F)(F)F)n1 |
| InChI | InChI=1S/C10H13F5N4O2/c11-9(12,10(13,14)15)8-17-7(18-21-8)6(16)5-19-1-3-20-4-2-19/h6H,1-5,16H2 |
| InChIKey | QIRJCWVTIZURJF-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.23 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|