C13H25N3O2 — CID 104636347
2-(5-heptyl-1,2,4-oxadiazol-3-yl)-1-methoxypropan-2-amine (PubChem CID 104636347) has the molecular formula C13H25N3O2 and a molecular weight of 255.36 g/mol. Its IUPAC name is 2-(5-heptyl-1,2,4-oxadiazol-3-yl)-1-methoxypropan-2-amine.
| Compound Name | 2-(5-heptyl-1,2,4-oxadiazol-3-yl)-1-methoxypropan-2-amine |
|---|---|
| PubChem CID | 104636347 |
| Molecular Formula | C13H25N3O2 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.19 |
| IUPAC Name | 2-(5-heptyl-1,2,4-oxadiazol-3-yl)-1-methoxypropan-2-amine |
| SMILES | CCCCCCCc1nc(C(C)(N)COC)no1 |
| InChI | InChI=1S/C13H25N3O2/c1-4-5-6-7-8-9-11-15-12(16-18-11)13(2,14)10-17-3/h4-10,14H2,1-3H3 |
| InChIKey | NAYMLBYPRCPBJP-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|