C10H19N3O4S — CID 104637046
2-[5-(methylsulfonylmethyl)-1,2,4-oxadiazol-3-yl]-1-propoxypropan-2-amine (PubChem CID 104637046) has the molecular formula C10H19N3O4S and a molecular weight of 277.35 g/mol. Its IUPAC name is 2-[5-(methylsulfonylmethyl)-1,2,4-oxadiazol-3-yl]-1-propoxypropan-2-amine.
| Compound Name | 2-[5-(methylsulfonylmethyl)-1,2,4-oxadiazol-3-yl]-1-propoxypropan-2-amine |
|---|---|
| PubChem CID | 104637046 |
| Molecular Formula | C10H19N3O4S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 2-[5-(methylsulfonylmethyl)-1,2,4-oxadiazol-3-yl]-1-propoxypropan-2-amine |
| SMILES | CCCOCC(C)(N)c1noc(CS(C)(=O)=O)n1 |
| InChI | InChI=1S/C10H19N3O4S/c1-4-5-16-7-10(2,11)9-12-8(17-13-9)6-18(3,14)15/h4-7,11H2,1-3H3 |
| InChIKey | LUJCPPLTRGYSIT-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 108.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|