C14H18FN3O — CID 104639319
(4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-(5-fluoro-2-pyridinyl)methanone (PubChem CID 104639319) has the molecular formula C14H18FN3O and a molecular weight of 263.32 g/mol. Its IUPAC name is (4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-(5-fluoro-2-pyridinyl)methanone.
| Compound Name | (4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-(5-fluoro-2-pyridinyl)methanone |
|---|---|
| PubChem CID | 104639319 |
| Molecular Formula | C14H18FN3O |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | (4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-(5-fluoro-2-pyridinyl)methanone |
| SMILES | CC1(C)C2CNCC2CN1C(=O)c1ccc(F)cn1 |
| InChI | InChI=1S/C14H18FN3O/c1-14(2)11-7-16-5-9(11)8-18(14)13(19)12-4-3-10(15)6-17-12/h3-4,6,9,11,16H,5,7-8H2,1-2H3 |
| InChIKey | JQCMINARBNOVFT-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |