C16H18BrN3O — CID 104641911
N-(2-bromo-3-methylphenyl)-5-(propylamino)pyridine-2-carboxamide (PubChem CID 104641911) has the molecular formula C16H18BrN3O and a molecular weight of 348.24 g/mol. Its IUPAC name is N-(2-bromo-3-methylphenyl)-5-(propylamino)pyridine-2-carboxamide.
| Compound Name | N-(2-bromo-3-methylphenyl)-5-(propylamino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 104641911 |
| Molecular Formula | C16H18BrN3O |
| Molecular Weight | 348.24 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | N-(2-bromo-3-methylphenyl)-5-(propylamino)pyridine-2-carboxamide |
| SMILES | CCCNc1ccc(C(=O)Nc2cccc(C)c2Br)nc1 |
| InChI | InChI=1S/C16H18BrN3O/c1-3-9-18-12-7-8-14(19-10-12)16(21)20-13-6-4-5-11(2)15(13)17/h4-8,10,18H,3,9H2,1-2H3,(H,20,21) |
| InChIKey | VCLKFPOFMDNFFR-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.24 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |