C12H18N4O2 — CID 104642643
5-hydrazinyl-N-[1-(oxolan-2-yl)ethyl]pyridine-2-carboxamide (PubChem CID 104642643) has the molecular formula C12H18N4O2 and a molecular weight of 250.30 g/mol. Its IUPAC name is 5-hydrazinyl-N-[1-(oxolan-2-yl)ethyl]pyridine-2-carboxamide.
| Compound Name | 5-hydrazinyl-N-[1-(oxolan-2-yl)ethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 104642643 |
| Molecular Formula | C12H18N4O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 5-hydrazinyl-N-[1-(oxolan-2-yl)ethyl]pyridine-2-carboxamide |
| SMILES | CC(NC(=O)c1ccc(NN)cn1)C1CCCO1 |
| InChI | InChI=1S/C12H18N4O2/c1-8(11-3-2-6-18-11)15-12(17)10-5-4-9(16-13)7-14-10/h4-5,7-8,11,16H,2-3,6,13H2,1H3,(H,15,17) |
| InChIKey | ISLPTPUHSNIAEB-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|