About trans-(1R,2R)-2-aminocyclopentan-1-ol
trans-(1R,2R)-2-aminocyclopentan-1-ol (PubChem CID 10464306) has the molecular formula C5H11NO
and a molecular weight of 101.15 g/mol. Its IUPAC name is trans-(1R,2R)-2-aminocyclopentan-1-ol.
Molecular Properties
| Compound Name | trans-(1R,2R)-2-aminocyclopentan-1-ol |
| PubChem CID | 10464306 |
| Molecular Formula | C5H11NO |
| Molecular Weight | 101.15 g/mol |
| Exact Mass | 101.08 |
| IUPAC Name | trans-(1R,2R)-2-aminocyclopentan-1-ol |
| SMILES | N[C@@H]1CCC[C@H]1O |
| InChI | InChI=1S/C5H11NO/c6-4-2-1-3-5(4)7/h4-5,7H,1-3,6H2/t4-,5-/m1/s1 |
| InChIKey | JFFOUICIRBXFRC-RFZPGFLSSA-N |
| XLogP | -0.14 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 101.15 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze trans-(1R,2R)-2-aminocyclopentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1R,2R)-2-aminocyclopentan-1-ol?
The IUPAC name of trans-(1R,2R)-2-aminocyclopentan-1-ol (CID 10464306) is trans-(1R,2R)-2-aminocyclopentan-1-ol.
What is the SMILES notation for trans-(1R,2R)-2-aminocyclopentan-1-ol?
The canonical SMILES for trans-(1R,2R)-2-aminocyclopentan-1-ol is N[C@@H]1CCC[C@H]1O.
What is the InChIKey of trans-(1R,2R)-2-aminocyclopentan-1-ol?
The InChIKey is JFFOUICIRBXFRC-RFZPGFLSSA-N. The full InChI is InChI=1S/C5H11NO/c6-4-2-1-3-5(4)7/h4-5,7H,1-3,6H2/t4-,5-/m1/s1.
What are the key properties of trans-(1R,2R)-2-aminocyclopentan-1-ol?
trans-(1R,2R)-2-aminocyclopentan-1-ol has a molecular weight of 101.15 g/mol, XLogP of -0.14, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1R,2R)-2-aminocyclopentan-1-ol is sourced from PubChem (CID 10464306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).