C7H3ClFN3S — CID 104643074
2-chloro-5-(5-fluoro-2-pyridinyl)-1,3,4-thiadiazole (PubChem CID 104643074) has the molecular formula C7H3ClFN3S and a molecular weight of 215.64 g/mol. Its IUPAC name is 2-chloro-5-(5-fluoro-2-pyridinyl)-1,3,4-thiadiazole.
| Compound Name | 2-chloro-5-(5-fluoro-2-pyridinyl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 104643074 |
| Molecular Formula | C7H3ClFN3S |
| Molecular Weight | 215.64 g/mol |
| Exact Mass | 214.97 |
| IUPAC Name | 2-chloro-5-(5-fluoro-2-pyridinyl)-1,3,4-thiadiazole |
| SMILES | Fc1ccc(-c2nnc(Cl)s2)nc1 |
| InChI | InChI=1S/C7H3ClFN3S/c8-7-12-11-6(13-7)5-2-1-4(9)3-10-5/h1-3H |
| InChIKey | SKNBSUXMRZTRKQ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.64 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |