About 2-ethoxy-1,1-difluoropropane
2-ethoxy-1,1-difluoropropane (PubChem CID 10464348) has the molecular formula C5H10F2O
and a molecular weight of 124.13 g/mol. Its IUPAC name is 2-ethoxy-1,1-difluoropropane.
Molecular Properties
| Compound Name | 2-ethoxy-1,1-difluoropropane |
| PubChem CID | 10464348 |
| Molecular Formula | C5H10F2O |
| Molecular Weight | 124.13 g/mol |
| Exact Mass | 124.07 |
| IUPAC Name | 2-ethoxy-1,1-difluoropropane |
| SMILES | CCOC(C)C(F)F |
| InChI | InChI=1S/C5H10F2O/c1-3-8-4(2)5(6)7/h4-5H,3H2,1-2H3 |
| InChIKey | RWXICWZMOKHYIH-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.13 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-ethoxy-1,1-difluoropropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-1,1-difluoropropane?
The IUPAC name of 2-ethoxy-1,1-difluoropropane (CID 10464348) is 2-ethoxy-1,1-difluoropropane.
What is the SMILES notation for 2-ethoxy-1,1-difluoropropane?
The canonical SMILES for 2-ethoxy-1,1-difluoropropane is CCOC(C)C(F)F.
What is the InChIKey of 2-ethoxy-1,1-difluoropropane?
The InChIKey is RWXICWZMOKHYIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10F2O/c1-3-8-4(2)5(6)7/h4-5H,3H2,1-2H3.
What are the key properties of 2-ethoxy-1,1-difluoropropane?
2-ethoxy-1,1-difluoropropane has a molecular weight of 124.13 g/mol, XLogP of 1.68, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-1,1-difluoropropane is sourced from PubChem (CID 10464348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).