About cis-(1R,5S)-5-amino-3,3-dimethylcyclohexan-1-ol
cis-(1R,5S)-5-amino-3,3-dimethylcyclohexan-1-ol (PubChem CID 10464432) has the molecular formula C8H17NO
and a molecular weight of 143.23 g/mol. Its IUPAC name is cis-(1R,5S)-5-amino-3,3-dimethylcyclohexan-1-ol.
Molecular Properties
| Compound Name | cis-(1R,5S)-5-amino-3,3-dimethylcyclohexan-1-ol |
| PubChem CID | 10464432 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | cis-(1R,5S)-5-amino-3,3-dimethylcyclohexan-1-ol |
| SMILES | CC1(C)C[C@H](N)C[C@H](O)C1 |
| InChI | InChI=1S/C8H17NO/c1-8(2)4-6(9)3-7(10)5-8/h6-7,10H,3-5,9H2,1-2H3/t6-,7+/m1/s1 |
| InChIKey | VPTMLCZYRTULJD-RQJHMYQMSA-N |
| XLogP | 0.88 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cis-(1R,5S)-5-amino-3,3-dimethylcyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1R,5S)-5-amino-3,3-dimethylcyclohexan-1-ol?
The IUPAC name of cis-(1R,5S)-5-amino-3,3-dimethylcyclohexan-1-ol (CID 10464432) is cis-(1R,5S)-5-amino-3,3-dimethylcyclohexan-1-ol.
What is the SMILES notation for cis-(1R,5S)-5-amino-3,3-dimethylcyclohexan-1-ol?
The canonical SMILES for cis-(1R,5S)-5-amino-3,3-dimethylcyclohexan-1-ol is CC1(C)C[C@H](N)C[C@H](O)C1.
What is the InChIKey of cis-(1R,5S)-5-amino-3,3-dimethylcyclohexan-1-ol?
The InChIKey is VPTMLCZYRTULJD-RQJHMYQMSA-N. The full InChI is InChI=1S/C8H17NO/c1-8(2)4-6(9)3-7(10)5-8/h6-7,10H,3-5,9H2,1-2H3/t6-,7+/m1/s1.
What are the key properties of cis-(1R,5S)-5-amino-3,3-dimethylcyclohexan-1-ol?
cis-(1R,5S)-5-amino-3,3-dimethylcyclohexan-1-ol has a molecular weight of 143.23 g/mol, XLogP of 0.88, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1R,5S)-5-amino-3,3-dimethylcyclohexan-1-ol is sourced from PubChem (CID 10464432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).