C10H19NO4 — CID 104644477
methyl 3-[(2-cyclopropyl-2-hydroxyethyl)amino]-2-hydroxy-2-methylpropanoate (PubChem CID 104644477) has the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. Its IUPAC name is methyl 3-[(2-cyclopropyl-2-hydroxyethyl)amino]-2-hydroxy-2-methylpropanoate.
| Compound Name | methyl 3-[(2-cyclopropyl-2-hydroxyethyl)amino]-2-hydroxy-2-methylpropanoate |
|---|---|
| PubChem CID | 104644477 |
| Molecular Formula | C10H19NO4 |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | methyl 3-[(2-cyclopropyl-2-hydroxyethyl)amino]-2-hydroxy-2-methylpropanoate |
| SMILES | COC(=O)C(C)(O)CNCC(O)C1CC1 |
| InChI | InChI=1S/C10H19NO4/c1-10(14,9(13)15-2)6-11-5-8(12)7-3-4-7/h7-8,11-12,14H,3-6H2,1-2H3 |
| InChIKey | ZCOTVDFGTABETB-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |