About 4-methoxy-5H-pyrrolo[3,2-d]pyrimidine
4-methoxy-5H-pyrrolo[3,2-d]pyrimidine (PubChem CID 10464488) has the molecular formula C7H7N3O
and a molecular weight of 149.15 g/mol. Its IUPAC name is 4-methoxy-5H-pyrrolo[3,2-d]pyrimidine.
Molecular Properties
| Compound Name | 4-methoxy-5H-pyrrolo[3,2-d]pyrimidine |
| PubChem CID | 10464488 |
| Molecular Formula | C7H7N3O |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.06 |
| IUPAC Name | 4-methoxy-5H-pyrrolo[3,2-d]pyrimidine |
| SMILES | COc1ncnc2cc[nH]c12 |
| InChI | InChI=1S/C7H7N3O/c1-11-7-6-5(2-3-8-6)9-4-10-7/h2-4,8H,1H3 |
| InChIKey | LUSAOPJMFGKLTG-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methoxy-5H-pyrrolo[3,2-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-5H-pyrrolo[3,2-d]pyrimidine?
The IUPAC name of 4-methoxy-5H-pyrrolo[3,2-d]pyrimidine (CID 10464488) is 4-methoxy-5H-pyrrolo[3,2-d]pyrimidine.
What is the SMILES notation for 4-methoxy-5H-pyrrolo[3,2-d]pyrimidine?
The canonical SMILES for 4-methoxy-5H-pyrrolo[3,2-d]pyrimidine is COc1ncnc2cc[nH]c12.
What is the InChIKey of 4-methoxy-5H-pyrrolo[3,2-d]pyrimidine?
The InChIKey is LUSAOPJMFGKLTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O/c1-11-7-6-5(2-3-8-6)9-4-10-7/h2-4,8H,1H3.
What are the key properties of 4-methoxy-5H-pyrrolo[3,2-d]pyrimidine?
4-methoxy-5H-pyrrolo[3,2-d]pyrimidine has a molecular weight of 149.15 g/mol, XLogP of 0.97, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-5H-pyrrolo[3,2-d]pyrimidine is sourced from PubChem (CID 10464488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).