C10H20O — CID 10464560
(Z)-4-methoxy-2,6-dimethylhept-3-ene (PubChem CID 10464560) has the molecular formula C10H20O and a molecular weight of 156.27 g/mol. Its IUPAC name is (Z)-4-methoxy-2,6-dimethylhept-3-ene.
| Compound Name | (Z)-4-methoxy-2,6-dimethylhept-3-ene |
|---|---|
| PubChem CID | 10464560 |
| Molecular Formula | C10H20O |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.15 |
| IUPAC Name | (Z)-4-methoxy-2,6-dimethylhept-3-ene |
| SMILES | CO/C(=C\C(C)C)CC(C)C |
| InChI | InChI=1S/C10H20O/c1-8(2)6-10(11-5)7-9(3)4/h6,8-9H,7H2,1-5H3/b10-6- |
| InChIKey | LLQMOTYDCLHZER-POHAHGRESA-N |
| XLogP | 3.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|