C7H8S2 — CID 10464615
1,2,3,4,5-pentadeuterio-6-(methyldisulfanyl)benzene (PubChem CID 10464615) has the molecular formula C7H8S2 and a molecular weight of 161.31 g/mol. Its IUPAC name is 1,2,3,4,5-pentadeuterio-6-(methyldisulfanyl)benzene.
| Compound Name | 1,2,3,4,5-pentadeuterio-6-(methyldisulfanyl)benzene |
|---|---|
| PubChem CID | 10464615 |
| Molecular Formula | C7H8S2 |
| Molecular Weight | 161.31 g/mol |
| Exact Mass | 161.04 |
| IUPAC Name | 1,2,3,4,5-pentadeuterio-6-(methyldisulfanyl)benzene |
| SMILES | [2H]c1c([2H])c([2H])c(SSC)c([2H])c1[2H] |
| InChI | InChI=1S/C7H8S2/c1-8-9-7-5-3-2-4-6-7/h2-6H,1H3/i2D,3D,4D,5D,6D |
| InChIKey | LMSQHVXHZCNJEP-VIQYUKPQSA-N |
| XLogP | 3.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.31 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|