C10H13NO — CID 10464645
6-[(1E,3E)-penta-1,3-dienyl]-2,3-dihydro-1H-pyridin-4-one (PubChem CID 10464645) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is 6-[(1E,3E)-penta-1,3-dienyl]-2,3-dihydro-1H-pyridin-4-one.
| Compound Name | 6-[(1E,3E)-penta-1,3-dienyl]-2,3-dihydro-1H-pyridin-4-one |
|---|---|
| PubChem CID | 10464645 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 6-[(1E,3E)-penta-1,3-dienyl]-2,3-dihydro-1H-pyridin-4-one |
| SMILES | C/C=C/C=C/C1=CC(=O)CCN1 |
| InChI | InChI=1S/C10H13NO/c1-2-3-4-5-9-8-10(12)6-7-11-9/h2-5,8,11H,6-7H2,1H3/b3-2+,5-4+ |
| InChIKey | JQRBQNKJVCLWIK-MQQKCMAXSA-N |
| XLogP | 1.57 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|