About 3-methoxy-2-nitroaniline
3-methoxy-2-nitroaniline (PubChem CID 10464700) has the molecular formula C7H8N2O3
and a molecular weight of 168.15 g/mol. Its IUPAC name is 3-methoxy-2-nitroaniline.
Molecular Properties
| Compound Name | 3-methoxy-2-nitroaniline |
| PubChem CID | 10464700 |
| Molecular Formula | C7H8N2O3 |
| Molecular Weight | 168.15 g/mol |
| Exact Mass | 168.05 |
| IUPAC Name | 3-methoxy-2-nitroaniline |
| SMILES | COc1cccc(N)c1[N+](=O)[O-] |
| InChI | InChI=1S/C7H8N2O3/c1-12-6-4-2-3-5(8)7(6)9(10)11/h2-4H,8H2,1H3 |
| InChIKey | RITQAMSEQYWFML-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.15 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-methoxy-2-nitroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-2-nitroaniline?
The IUPAC name of 3-methoxy-2-nitroaniline (CID 10464700) is 3-methoxy-2-nitroaniline.
What is the SMILES notation for 3-methoxy-2-nitroaniline?
The canonical SMILES for 3-methoxy-2-nitroaniline is COc1cccc(N)c1[N+](=O)[O-].
What is the InChIKey of 3-methoxy-2-nitroaniline?
The InChIKey is RITQAMSEQYWFML-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O3/c1-12-6-4-2-3-5(8)7(6)9(10)11/h2-4H,8H2,1H3.
What are the key properties of 3-methoxy-2-nitroaniline?
3-methoxy-2-nitroaniline has a molecular weight of 168.15 g/mol, XLogP of 1.19, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-2-nitroaniline is sourced from PubChem (CID 10464700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).