2-phenyl-2-sulfanylacetic acid

C8H8O2S — CID 10464709

IUPAC2-phenyl-2-sulfanylacetic acid
SMILESO=C(O)C(S)c1ccccc1
InChIInChI=1S/C8H8O2S/c9-8(10)7(11)6-4-2-1-3-5-6/h1-5,7,11H,(H,9,10)
InChIKeyQYIGFZOHYGYBLX-UHFFFAOYSA-N
MW168.22 g/mol
LogP1.74
Rot. Bonds2

About 2-phenyl-2-sulfanylacetic acid

2-phenyl-2-sulfanylacetic acid (PubChem CID 10464709) has the molecular formula C8H8O2S and a molecular weight of 168.22 g/mol. Its IUPAC name is 2-phenyl-2-sulfanylacetic acid.

Molecular Properties

Compound Name2-phenyl-2-sulfanylacetic acid
PubChem CID10464709
Molecular FormulaC8H8O2S
Molecular Weight168.22 g/mol
Exact Mass168.02
IUPAC Name2-phenyl-2-sulfanylacetic acid
SMILESO=C(O)C(S)c1ccccc1
InChIInChI=1S/C8H8O2S/c9-8(10)7(11)6-4-2-1-3-5-6/h1-5,7,11H,(H,9,10)
InChIKeyQYIGFZOHYGYBLX-UHFFFAOYSA-N
XLogP1.74
TPSA37.30 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500168.22
LogP ≤ 51.74
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'thiol_2', 'substructure': 'N/A'}

Analyze 2-phenyl-2-sulfanylacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-phenyl-2-sulfanylacetic acid?
The IUPAC name of 2-phenyl-2-sulfanylacetic acid (CID 10464709) is 2-phenyl-2-sulfanylacetic acid.
What is the SMILES notation for 2-phenyl-2-sulfanylacetic acid?
The canonical SMILES for 2-phenyl-2-sulfanylacetic acid is O=C(O)C(S)c1ccccc1.
What is the InChIKey of 2-phenyl-2-sulfanylacetic acid?
The InChIKey is QYIGFZOHYGYBLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O2S/c9-8(10)7(11)6-4-2-1-3-5-6/h1-5,7,11H,(H,9,10).
What are the key properties of 2-phenyl-2-sulfanylacetic acid?
2-phenyl-2-sulfanylacetic acid has a molecular weight of 168.22 g/mol, XLogP of 1.74, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-2-sulfanylacetic acid is sourced from PubChem (CID 10464709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).