C16H26BrNO2 — CID 104647191
N-[[5-bromo-2-(4-methoxybutoxy)-3-methylphenyl]methyl]propan-2-amine (PubChem CID 104647191) has the molecular formula C16H26BrNO2 and a molecular weight of 344.29 g/mol. Its IUPAC name is N-[[5-bromo-2-(4-methoxybutoxy)-3-methylphenyl]methyl]propan-2-amine.
| Compound Name | N-[[5-bromo-2-(4-methoxybutoxy)-3-methylphenyl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 104647191 |
| Molecular Formula | C16H26BrNO2 |
| Molecular Weight | 344.29 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | N-[[5-bromo-2-(4-methoxybutoxy)-3-methylphenyl]methyl]propan-2-amine |
| SMILES | COCCCCOc1c(C)cc(Br)cc1CNC(C)C |
| InChI | InChI=1S/C16H26BrNO2/c1-12(2)18-11-14-10-15(17)9-13(3)16(14)20-8-6-5-7-19-4/h9-10,12,18H,5-8,11H2,1-4H3 |
| InChIKey | ODVYMKXGQTWNOT-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.29 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|