C8H15NO3 — CID 10464777
(3aS,7R,7aR)-2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-[1,3]dioxolo[4,5-c]pyridin-7-ol (PubChem CID 10464777) has the molecular formula C8H15NO3 and a molecular weight of 173.21 g/mol. Its IUPAC name is (3aS,7R,7aR)-2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-[1,3]dioxolo[4,5-c]pyridin-7-ol.
| Compound Name | (3aS,7R,7aR)-2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-[1,3]dioxolo[4,5-c]pyridin-7-ol |
|---|---|
| PubChem CID | 10464777 |
| Molecular Formula | C8H15NO3 |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | (3aS,7R,7aR)-2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-[1,3]dioxolo[4,5-c]pyridin-7-ol |
| SMILES | CC1(C)O[C@@H]2[C@H](O)CNC[C@@H]2O1 |
| InChI | InChI=1S/C8H15NO3/c1-8(2)11-6-4-9-3-5(10)7(6)12-8/h5-7,9-10H,3-4H2,1-2H3/t5-,6+,7-/m1/s1 |
| InChIKey | AYRVEFWNEXJRHZ-DSYKOEDSSA-N |
| XLogP | -0.53 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |