C10H14N2O — CID 10464886
1-imidazol-1-yl-2,2,3-trimethylbut-3-en-1-one (PubChem CID 10464886) has the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. Its IUPAC name is 1-imidazol-1-yl-2,2,3-trimethylbut-3-en-1-one.
| Compound Name | 1-imidazol-1-yl-2,2,3-trimethylbut-3-en-1-one |
|---|---|
| PubChem CID | 10464886 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 1-imidazol-1-yl-2,2,3-trimethylbut-3-en-1-one |
| SMILES | C=C(C)C(C)(C)C(=O)n1ccnc1 |
| InChI | InChI=1S/C10H14N2O/c1-8(2)10(3,4)9(13)12-6-5-11-7-12/h5-7H,1H2,2-4H3 |
| InChIKey | QTGXXXBGAQFIQA-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|