C7H14O3S — CID 10464889
(E,3S)-1-methylsulfonylhex-1-en-3-ol (PubChem CID 10464889) has the molecular formula C7H14O3S and a molecular weight of 178.25 g/mol. Its IUPAC name is (E,3S)-1-methylsulfonylhex-1-en-3-ol.
| Compound Name | (E,3S)-1-methylsulfonylhex-1-en-3-ol |
|---|---|
| PubChem CID | 10464889 |
| Molecular Formula | C7H14O3S |
| Molecular Weight | 178.25 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | (E,3S)-1-methylsulfonylhex-1-en-3-ol |
| SMILES | CCC[C@H](O)/C=C/S(C)(=O)=O |
| InChI | InChI=1S/C7H14O3S/c1-3-4-7(8)5-6-11(2,9)10/h5-8H,3-4H2,1-2H3/b6-5+/t7-/m0/s1 |
| InChIKey | FCLQAIVXQVDPOI-XPPMVYLVSA-N |
| XLogP | 0.71 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.25 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |