C16H26BrNO — CID 104649517
2-(2-bromophenyl)-6-methoxy-N-propylhexan-1-amine (PubChem CID 104649517) has the molecular formula C16H26BrNO and a molecular weight of 328.29 g/mol. Its IUPAC name is 2-(2-bromophenyl)-6-methoxy-N-propylhexan-1-amine.
| Compound Name | 2-(2-bromophenyl)-6-methoxy-N-propylhexan-1-amine |
|---|---|
| PubChem CID | 104649517 |
| Molecular Formula | C16H26BrNO |
| Molecular Weight | 328.29 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 2-(2-bromophenyl)-6-methoxy-N-propylhexan-1-amine |
| SMILES | CCCNCC(CCCCOC)c1ccccc1Br |
| InChI | InChI=1S/C16H26BrNO/c1-3-11-18-13-14(8-6-7-12-19-2)15-9-4-5-10-16(15)17/h4-5,9-10,14,18H,3,6-8,11-13H2,1-2H3 |
| InChIKey | WHUOTOSYCUILHD-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.29 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|