(2S)-2-amino-3-(2,5-dioxopyrrol-3-yl)propanoic acid

C7H8N2O4 — CID 10464987

IUPAC(2S)-2-amino-3-(2,5-dioxopyrrol-3-yl)propanoic acid
SMILESN[C@@H](CC1=CC(=O)NC1=O)C(=O)O
InChIInChI=1S/C7H8N2O4/c8-4(7(12)13)1-3-2-5(10)9-6(3)11/h2,4H,1,8H2,(H,12,13)(H,9,10,11)/t4-/m0/s1
InChIKeyLNJRVBOKGUWWPH-BYPYZUCNSA-N
MW184.15 g/mol
LogP-1.63
Rot. Bonds3

About (2S)-2-amino-3-(2,5-dioxopyrrol-3-yl)propanoic acid

(2S)-2-amino-3-(2,5-dioxopyrrol-3-yl)propanoic acid (PubChem CID 10464987) has the molecular formula C7H8N2O4 and a molecular weight of 184.15 g/mol. Its IUPAC name is (2S)-2-amino-3-(2,5-dioxopyrrol-3-yl)propanoic acid.

Molecular Properties

Compound Name(2S)-2-amino-3-(2,5-dioxopyrrol-3-yl)propanoic acid
PubChem CID10464987
Molecular FormulaC7H8N2O4
Molecular Weight184.15 g/mol
Exact Mass184.05
IUPAC Name(2S)-2-amino-3-(2,5-dioxopyrrol-3-yl)propanoic acid
SMILESN[C@@H](CC1=CC(=O)NC1=O)C(=O)O
InChIInChI=1S/C7H8N2O4/c8-4(7(12)13)1-3-2-5(10)9-6(3)11/h2,4H,1,8H2,(H,12,13)(H,9,10,11)/t4-/m0/s1
InChIKeyLNJRVBOKGUWWPH-BYPYZUCNSA-N
XLogP-1.63
TPSA109.49 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500184.15
LogP ≤ 5-1.63
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phthalimide', 'substructure': 'N/A'}

Analyze (2S)-2-amino-3-(2,5-dioxopyrrol-3-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-2-amino-3-(2,5-dioxopyrrol-3-yl)propanoic acid?
The IUPAC name of (2S)-2-amino-3-(2,5-dioxopyrrol-3-yl)propanoic acid (CID 10464987) is (2S)-2-amino-3-(2,5-dioxopyrrol-3-yl)propanoic acid.
What is the SMILES notation for (2S)-2-amino-3-(2,5-dioxopyrrol-3-yl)propanoic acid?
The canonical SMILES for (2S)-2-amino-3-(2,5-dioxopyrrol-3-yl)propanoic acid is N[C@@H](CC1=CC(=O)NC1=O)C(=O)O.
What is the InChIKey of (2S)-2-amino-3-(2,5-dioxopyrrol-3-yl)propanoic acid?
The InChIKey is LNJRVBOKGUWWPH-BYPYZUCNSA-N. The full InChI is InChI=1S/C7H8N2O4/c8-4(7(12)13)1-3-2-5(10)9-6(3)11/h2,4H,1,8H2,(H,12,13)(H,9,10,11)/t4-/m0/s1.
What are the key properties of (2S)-2-amino-3-(2,5-dioxopyrrol-3-yl)propanoic acid?
(2S)-2-amino-3-(2,5-dioxopyrrol-3-yl)propanoic acid has a molecular weight of 184.15 g/mol, XLogP of -1.63, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-3-(2,5-dioxopyrrol-3-yl)propanoic acid is sourced from PubChem (CID 10464987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).