About CID 10465026
CID 10465026 (PubChem CID 10465026) has the molecular formula C10H10Fe+2
and a molecular weight of 186.03 g/mol.
Molecular Properties
| Compound Name | CID 10465026 |
| PubChem CID | 10465026 |
| Molecular Formula | C10H10Fe+2 |
| Molecular Weight | 186.03 g/mol |
| Exact Mass | 186.01 |
| IUPAC Name | — |
| SMILES | [CH]1[CH][CH][CH][CH]1.[CH]1[CH][CH][CH][CH]1.[Fe+2] |
| InChI | InChI=1S/2C5H5.Fe/c2*1-2-4-5-3-1;/h2*1-5H;/q;;+2 |
| InChIKey | HCLPIWAXOUYEDJ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.03 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 10465026 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 10465026?
The IUPAC name of CID 10465026 (CID 10465026) is not available.
What is the SMILES notation for CID 10465026?
The canonical SMILES for CID 10465026 is [CH]1[CH][CH][CH][CH]1.[CH]1[CH][CH][CH][CH]1.[Fe+2].
What is the InChIKey of CID 10465026?
The InChIKey is HCLPIWAXOUYEDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H5.Fe/c2*1-2-4-5-3-1;/h2*1-5H;/q;;+2.
What are the key properties of CID 10465026?
CID 10465026 has a molecular weight of 186.03 g/mol, XLogP of 2.04, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 10465026 is sourced from PubChem (CID 10465026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).