C13H12FNO3S — CID 104651306
2-[(2-ethyl-1,3-thiazol-4-yl)methoxy]-6-fluorobenzoic acid (PubChem CID 104651306) has the molecular formula C13H12FNO3S and a molecular weight of 281.31 g/mol. Its IUPAC name is 2-[(2-ethyl-1,3-thiazol-4-yl)methoxy]-6-fluorobenzoic acid.
| Compound Name | 2-[(2-ethyl-1,3-thiazol-4-yl)methoxy]-6-fluorobenzoic acid |
|---|---|
| PubChem CID | 104651306 |
| Molecular Formula | C13H12FNO3S |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | 2-[(2-ethyl-1,3-thiazol-4-yl)methoxy]-6-fluorobenzoic acid |
| SMILES | CCc1nc(COc2cccc(F)c2C(=O)O)cs1 |
| InChI | InChI=1S/C13H12FNO3S/c1-2-11-15-8(7-19-11)6-18-10-5-3-4-9(14)12(10)13(16)17/h3-5,7H,2,6H2,1H3,(H,16,17) |
| InChIKey | HOABNCRATHOSFA-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |