About 1-[5-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]furan-2-yl]ethanone
1-[5-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]furan-2-yl]ethanone (PubChem CID 104651968) has the molecular formula C9H9N3O2S
and a molecular weight of 223.26 g/mol. Its IUPAC name is 1-[5-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]furan-2-yl]ethanone.
Molecular Properties
| Compound Name | 1-[5-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]furan-2-yl]ethanone |
| PubChem CID | 104651968 |
| Molecular Formula | C9H9N3O2S |
| Molecular Weight | 223.26 g/mol |
| Exact Mass | 223.04 |
| IUPAC Name | 1-[5-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]furan-2-yl]ethanone |
| SMILES | CC(=O)c1ccc(Sc2ncnn2C)o1 |
| InChI | InChI=1S/C9H9N3O2S/c1-6(13)7-3-4-8(14-7)15-9-10-5-11-12(9)2/h3-5H,1-2H3 |
| InChIKey | XECSIMKKXMHERX-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 60.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.26 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[5-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]furan-2-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]furan-2-yl]ethanone?
The IUPAC name of 1-[5-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]furan-2-yl]ethanone (CID 104651968) is 1-[5-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]furan-2-yl]ethanone.
What is the SMILES notation for 1-[5-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]furan-2-yl]ethanone?
The canonical SMILES for 1-[5-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]furan-2-yl]ethanone is CC(=O)c1ccc(Sc2ncnn2C)o1.
What is the InChIKey of 1-[5-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]furan-2-yl]ethanone?
The InChIKey is XECSIMKKXMHERX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3O2S/c1-6(13)7-3-4-8(14-7)15-9-10-5-11-12(9)2/h3-5H,1-2H3.
What are the key properties of 1-[5-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]furan-2-yl]ethanone?
1-[5-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]furan-2-yl]ethanone has a molecular weight of 223.26 g/mol, XLogP of 1.76, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]furan-2-yl]ethanone is sourced from PubChem (CID 104651968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).